C15H21N5O3S — CID 145287123
(Z)-3-(methylideneamino)-N-[[5-methyl-4-(1-oxo-1,4-thiazinane-4-carbonyl)pyrazol-1-yl]methyl]but-2-enamide (PubChem CID 145287123) has the molecular formula C15H21N5O3S and a molecular weight of 351.43 g/mol. Its IUPAC name is (Z)-3-(methylideneamino)-N-[[5-methyl-4-(1-oxo-1,4-thiazinane-4-carbonyl)pyrazol-1-yl]methyl]but-2-enamide.
| Compound Name | (Z)-3-(methylideneamino)-N-[[5-methyl-4-(1-oxo-1,4-thiazinane-4-carbonyl)pyrazol-1-yl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 145287123 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (Z)-3-(methylideneamino)-N-[[5-methyl-4-(1-oxo-1,4-thiazinane-4-carbonyl)pyrazol-1-yl]methyl]but-2-enamide |
| SMILES | C=N/C(C)=C\C(=O)NCn1ncc(C(=O)N2CCS(=O)CC2)c1C |
| InChI | InChI=1S/C15H21N5O3S/c1-11(16-3)8-14(21)17-10-20-12(2)13(9-18-20)15(22)19-4-6-24(23)7-5-19/h8-9H,3-7,10H2,1-2H3,(H,17,21)/b11-8- |
| InChIKey | ULCGMJWNFAOZSB-FLIBITNWSA-N |
| XLogP | 0.07 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|