C18H24F3N5O4S — CID 143614615
N-[2-[[1-[(2Z,4Z)-hexa-2,4-dienyl]-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide (PubChem CID 143614615) has the molecular formula C18H24F3N5O4S and a molecular weight of 463.48 g/mol. Its IUPAC name is N-[2-[[1-[(2Z,4Z)-hexa-2,4-dienyl]-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide.
| Compound Name | N-[2-[[1-[(2Z,4Z)-hexa-2,4-dienyl]-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 143614615 |
| Molecular Formula | C18H24F3N5O4S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[2-[[1-[(2Z,4Z)-hexa-2,4-dienyl]-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide |
| SMILES | C/C=C\C=C/Cn1cc(C(=O)NCCNC(=O)N2CCS(=O)(=O)CC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H24F3N5O4S/c1-2-3-4-5-8-26-13-14(15(24-26)18(19,20)21)16(27)22-6-7-23-17(28)25-9-11-31(29,30)12-10-25/h2-5,13H,6-12H2,1H3,(H,22,27)(H,23,28)/b3-2-,5-4- |
| InChIKey | QVMNHCHJAUABFP-LDIADDGTSA-N |
| XLogP | 1.20 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|