C9H16N2O — CID 145287260
ethane;2,3,6-trimethylpyrimidin-4-one (PubChem CID 145287260) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is ethane;2,3,6-trimethylpyrimidin-4-one.
| Compound Name | ethane;2,3,6-trimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 145287260 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | ethane;2,3,6-trimethylpyrimidin-4-one |
| SMILES | CC.Cc1cc(=O)n(C)c(C)n1 |
| InChI | InChI=1S/C7H10N2O.C2H6/c1-5-4-7(10)9(3)6(2)8-5;1-2/h4H,1-3H3;1-2H3 |
| InChIKey | WLHUKIVMZAABRT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |