C13H19N5 — CID 145287800
(Z,3Z)-3-(ethylaminomethylimino)-N-methyl-1-(methylideneamino)-2-pyridin-2-ylprop-1-en-1-amine (PubChem CID 145287800) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is (Z,3Z)-3-(ethylaminomethylimino)-N-methyl-1-(methylideneamino)-2-pyridin-2-ylprop-1-en-1-amine.
| Compound Name | (Z,3Z)-3-(ethylaminomethylimino)-N-methyl-1-(methylideneamino)-2-pyridin-2-ylprop-1-en-1-amine |
|---|---|
| PubChem CID | 145287800 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (Z,3Z)-3-(ethylaminomethylimino)-N-methyl-1-(methylideneamino)-2-pyridin-2-ylprop-1-en-1-amine |
| SMILES | C=N/C(NC)=C(\C=N/CNCC)c1ccccn1 |
| InChI | InChI=1S/C13H19N5/c1-4-16-10-17-9-11(13(14-2)15-3)12-7-5-6-8-18-12/h5-9,15-16H,2,4,10H2,1,3H3/b13-11-,17-9- |
| InChIKey | DXUFTBIWGMTHEW-ZCYUMKDRSA-N |
| XLogP | 1.31 |
| TPSA | 61.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|