C11H13N3O2 — CID 173273862
3-(methylamino)-N-(2-oxoethyl)-3-pyridin-2-ylprop-2-enamide (PubChem CID 173273862) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(methylamino)-N-(2-oxoethyl)-3-pyridin-2-ylprop-2-enamide.
| Compound Name | 3-(methylamino)-N-(2-oxoethyl)-3-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 173273862 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-(methylamino)-N-(2-oxoethyl)-3-pyridin-2-ylprop-2-enamide |
| SMILES | CNC(=CC(=O)NCC=O)c1ccccn1 |
| InChI | InChI=1S/C11H13N3O2/c1-12-10(8-11(16)14-6-7-15)9-4-2-3-5-13-9/h2-5,7-8,12H,6H2,1H3,(H,14,16) |
| InChIKey | SHYPSVQJAVASCV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|