C20H22F4N4O — CID 145289079
3-[ethenyl-[(Z)-hydrazinylidenemethyl]amino]-5-(4-fluorophenyl)-N-(1,1,1-trifluoro-2-methylpropan-2-yl)benzamide;molecular hydrogen (PubChem CID 145289079) has the molecular formula C20H22F4N4O and a molecular weight of 410.42 g/mol. Its IUPAC name is 3-[ethenyl-[(Z)-hydrazinylidenemethyl]amino]-5-(4-fluorophenyl)-N-(1,1,1-trifluoro-2-methylpropan-2-yl)benzamide;molecular hydrogen.
| Compound Name | 3-[ethenyl-[(Z)-hydrazinylidenemethyl]amino]-5-(4-fluorophenyl)-N-(1,1,1-trifluoro-2-methylpropan-2-yl)benzamide;molecular hydrogen |
|---|---|
| PubChem CID | 145289079 |
| Molecular Formula | C20H22F4N4O |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-[ethenyl-[(Z)-hydrazinylidenemethyl]amino]-5-(4-fluorophenyl)-N-(1,1,1-trifluoro-2-methylpropan-2-yl)benzamide;molecular hydrogen |
| SMILES | C=CN(/C=N\N)c1cc(C(=O)NC(C)(C)C(F)(F)F)cc(-c2ccc(F)cc2)c1.[H][H] |
| InChI | InChI=1S/C20H20F4N4O.H2/c1-4-28(12-26-25)17-10-14(13-5-7-16(21)8-6-13)9-15(11-17)18(29)27-19(2,3)20(22,23)24;/h4-12H,1,25H2,2-3H3,(H,27,29);1H/b26-12-; |
| InChIKey | XSVWITHVKRASBT-RJWBHYTESA-N |
| XLogP | 4.66 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|