C20H23ClN4O — CID 129024852
N-tert-butyl-3-(4-chlorophenyl)-5-[ethanimidoyl(methanimidoyl)amino]benzamide (PubChem CID 129024852) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is N-tert-butyl-3-(4-chlorophenyl)-5-[ethanimidoyl(methanimidoyl)amino]benzamide.
| Compound Name | N-tert-butyl-3-(4-chlorophenyl)-5-[ethanimidoyl(methanimidoyl)amino]benzamide |
|---|---|
| PubChem CID | 129024852 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-tert-butyl-3-(4-chlorophenyl)-5-[ethanimidoyl(methanimidoyl)amino]benzamide |
| SMILES | [H]/N=C/N(/C(C)=N/[H])c1cc(C(=O)NC(C)(C)C)cc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H23ClN4O/c1-13(23)25(12-22)18-10-15(14-5-7-17(21)8-6-14)9-16(11-18)19(26)24-20(2,3)4/h5-12,22-23H,1-4H3,(H,24,26)/b22-12+,23-13+ |
| InChIKey | YMFGRMFWGPGMQT-FWSOMWAYSA-N |
| XLogP | 4.95 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|