C12H20N4O2 — CID 145289747
methyl (Z)-3-[(1R)-2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-2-methanimidoylbut-2-enoate (PubChem CID 145289747) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is methyl (Z)-3-[(1R)-2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-2-methanimidoylbut-2-enoate.
| Compound Name | methyl (Z)-3-[(1R)-2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-2-methanimidoylbut-2-enoate |
|---|---|
| PubChem CID | 145289747 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | methyl (Z)-3-[(1R)-2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-2-methanimidoylbut-2-enoate |
| SMILES | [H]/N=C/C(C(=O)OC)=C(\C)[C@@H]1CC1/C(N)=C/N(C)N |
| InChI | InChI=1S/C12H20N4O2/c1-7(10(5-13)12(17)18-3)8-4-9(8)11(14)6-16(2)15/h5-6,8-9,13H,4,14-15H2,1-3H3/b10-7-,11-6-,13-5+/t8-,9?/m0/s1 |
| InChIKey | DSKPBKBWQAUIER-LFSZPWNXSA-N |
| XLogP | 0.37 |
| TPSA | 105.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|