C23H41N3O4 — CID 145290672
(2Z)-5-methyl-2-(methylamino)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]hexa-2,4-dienoic acid;propane (PubChem CID 145290672) has the molecular formula C23H41N3O4 and a molecular weight of 423.60 g/mol. Its IUPAC name is (2Z)-5-methyl-2-(methylamino)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]hexa-2,4-dienoic acid;propane.
| Compound Name | (2Z)-5-methyl-2-(methylamino)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]hexa-2,4-dienoic acid;propane |
|---|---|
| PubChem CID | 145290672 |
| Molecular Formula | C23H41N3O4 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | (2Z)-5-methyl-2-(methylamino)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]hexa-2,4-dienoic acid;propane |
| SMILES | CCC.CN/C(=C\C(=C(C)C)N1CCC2C(CCN2C(=O)OC(C)(C)C)C1)C(=O)O |
| InChI | InChI=1S/C20H33N3O4.C3H8/c1-13(2)17(11-15(21-6)18(24)25)22-9-8-16-14(12-22)7-10-23(16)19(26)27-20(3,4)5;1-3-2/h11,14,16,21H,7-10,12H2,1-6H3,(H,24,25);3H2,1-2H3/b15-11-; |
| InChIKey | WFZFLMOUHHUGOI-PNCOJPCNSA-N |
| XLogP | 4.22 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|