C27H30F3N4O3+ — CID 145290753
[6-carboxy-4-[4-[2-methoxyethyl(methyl)amino]phenyl]-3-(2-methylpropanimidoyl)-2-pyridinyl]-[3-(trifluoromethyl)phenyl]azanium (PubChem CID 145290753) has the molecular formula C27H30F3N4O3+ and a molecular weight of 515.56 g/mol. Its IUPAC name is [6-carboxy-4-[4-[2-methoxyethyl(methyl)amino]phenyl]-3-(2-methylpropanimidoyl)-2-pyridinyl]-[3-(trifluoromethyl)phenyl]azanium.
| Compound Name | [6-carboxy-4-[4-[2-methoxyethyl(methyl)amino]phenyl]-3-(2-methylpropanimidoyl)-2-pyridinyl]-[3-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 145290753 |
| Molecular Formula | C27H30F3N4O3+ |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | [6-carboxy-4-[4-[2-methoxyethyl(methyl)amino]phenyl]-3-(2-methylpropanimidoyl)-2-pyridinyl]-[3-(trifluoromethyl)phenyl]azanium |
| SMILES | [H]/N=C(/c1c(-c2ccc(N(C)CCOC)cc2)cc(C(=O)O)nc1[NH2+]c1cccc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C27H29F3N4O3/c1-16(2)24(31)23-21(17-8-10-20(11-9-17)34(3)12-13-37-4)15-22(26(35)36)33-25(23)32-19-7-5-6-18(14-19)27(28,29)30/h5-11,14-16,31H,12-13H2,1-4H3,(H,32,33)(H,35,36)/p+1/b31-24+ |
| InChIKey | ZVJPAPXALOLOOR-QFMPWRQOSA-O |
| XLogP | 5.10 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|