C22H16F3N3O2 — CID 15890328
2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]amino]ethyl benzoate (PubChem CID 15890328) has the molecular formula C22H16F3N3O2 and a molecular weight of 411.38 g/mol. Its IUPAC name is 2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]amino]ethyl benzoate.
| Compound Name | 2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]amino]ethyl benzoate |
|---|---|
| PubChem CID | 15890328 |
| Molecular Formula | C22H16F3N3O2 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]amino]ethyl benzoate |
| SMILES | N#Cc1c(C(F)(F)F)cc(-c2ccccc2)nc1NCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H16F3N3O2/c23-22(24,25)18-13-19(15-7-3-1-4-8-15)28-20(17(18)14-26)27-11-12-30-21(29)16-9-5-2-6-10-16/h1-10,13H,11-12H2,(H,27,28) |
| InChIKey | MFZGUYMISLFFJH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|