C15H20N2O2 — CID 145290966
4-[3-(4-aminocyclohexa-2,4-dien-1-yl)oxypropoxy]aniline (PubChem CID 145290966) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-[3-(4-aminocyclohexa-2,4-dien-1-yl)oxypropoxy]aniline.
| Compound Name | 4-[3-(4-aminocyclohexa-2,4-dien-1-yl)oxypropoxy]aniline |
|---|---|
| PubChem CID | 145290966 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 4-[3-(4-aminocyclohexa-2,4-dien-1-yl)oxypropoxy]aniline |
| SMILES | NC1=CCC(OCCCOc2ccc(N)cc2)C=C1 |
| InChI | InChI=1S/C15H20N2O2/c16-12-2-6-14(7-3-12)18-10-1-11-19-15-8-4-13(17)5-9-15/h2-8,15H,1,9-11,16-17H2 |
| InChIKey | PSNJTUHSGDWXQJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|