About 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide
4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide (PubChem CID 163756289) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide.
Molecular Properties
| Compound Name | 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide |
| PubChem CID | 163756289 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide |
| SMILES | NOC1C=CC([NH+]([O-])Oc2ccc(N)cc2)=CC1 |
| InChI | InChI=1S/C12H15N3O3/c13-9-1-5-12(6-2-9)18-15(16)10-3-7-11(17-14)8-4-10/h1-7,11,15H,8,13-14H2 |
| InChIKey | LUIQYPAMMOPZQE-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide?
The IUPAC name of 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide (CID 163756289) is 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide.
What is the SMILES notation for 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide?
The canonical SMILES for 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide is NOC1C=CC([NH+]([O-])Oc2ccc(N)cc2)=CC1.
What is the InChIKey of 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide?
The InChIKey is LUIQYPAMMOPZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3/c13-9-1-5-12(6-2-9)18-15(16)10-3-7-11(17-14)8-4-10/h1-7,11,15H,8,13-14H2.
What are the key properties of 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide?
4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide has a molecular weight of 249.27 g/mol, XLogP of 0.05, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminooxy-N-(4-aminophenoxy)cyclohexa-1,5-dien-1-amine oxide is sourced from PubChem (CID 163756289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).