C27H30 — CID 145291947
2-ethenyl-1',1',2',3'-tetramethyl-3-propylspiro[indene-1,4'-naphthalene] (PubChem CID 145291947) has the molecular formula C27H30 and a molecular weight of 354.54 g/mol. Its IUPAC name is 2-ethenyl-1',1',2',3'-tetramethyl-3-propylspiro[indene-1,4'-naphthalene].
| Compound Name | 2-ethenyl-1',1',2',3'-tetramethyl-3-propylspiro[indene-1,4'-naphthalene] |
|---|---|
| PubChem CID | 145291947 |
| Molecular Formula | C27H30 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 2-ethenyl-1',1',2',3'-tetramethyl-3-propylspiro[indene-1,4'-naphthalene] |
| SMILES | C=CC1=C(CCC)c2ccccc2C12C(C)=C(C)C(C)(C)c1ccccc12 |
| InChI | InChI=1S/C27H30/c1-7-13-20-21-14-9-10-15-23(21)27(22(20)8-2)19(4)18(3)26(5,6)24-16-11-12-17-25(24)27/h8-12,14-17H,2,7,13H2,1,3-6H3 |
| InChIKey | SBRMHXQWVPEXIE-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|