C66H58 — CID 145291950
CID 145291950 (PubChem CID 145291950) has the molecular formula C66H58 and a molecular weight of 851.19 g/mol.
| Compound Name | CID 145291950 |
|---|---|
| PubChem CID | 145291950 |
| Molecular Formula | C66H58 |
| Molecular Weight | 851.19 g/mol |
| Exact Mass | 850.45 |
| IUPAC Name | — |
| SMILES | C=C1/C=C\CC/C(C)=C(/C=C\CC)C12c1ccccc1C1(c3ccc(-c4ccc(/C(=C/CC5=CC=CC5)c5ccccc5)cc4)cc3-c3c1ccc(C1=C(C)CC=C1)c3C)c1ccccc12 |
| InChI | InChI=1S/C66H58/c1-6-7-28-57-45(3)20-11-12-22-46(4)65(57)59-29-15-17-31-61(59)66(62-32-18-16-30-60(62)65)58-41-38-52(43-56(58)64-47(5)54(40-42-63(64)66)53-27-19-21-44(53)2)49-34-36-51(37-35-49)55(50-25-9-8-10-26-50)39-33-48-23-13-14-24-48/h7-10,12-19,22-23,25-32,34-43H,4,6,11,20-21,24,33H2,1-3,5H3/b22-12-,28-7-,55-39+,57-45- |
| InChIKey | MHEURACQBXNSJX-RMPXXDSDSA-N |
| XLogP | 17.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.19 |
| LogP ≤ 5 | 17.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |