C32H31N — CID 135199373
2-[9-[(2E,4Z)-hepta-2,4-dien-2-yl]-9-phenylfluoren-2-yl]cyclohexa-1,3-dien-1-amine (PubChem CID 135199373) has the molecular formula C32H31N and a molecular weight of 429.61 g/mol. Its IUPAC name is 2-[9-[(2E,4Z)-hepta-2,4-dien-2-yl]-9-phenylfluoren-2-yl]cyclohexa-1,3-dien-1-amine.
| Compound Name | 2-[9-[(2E,4Z)-hepta-2,4-dien-2-yl]-9-phenylfluoren-2-yl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 135199373 |
| Molecular Formula | C32H31N |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 2-[9-[(2E,4Z)-hepta-2,4-dien-2-yl]-9-phenylfluoren-2-yl]cyclohexa-1,3-dien-1-amine |
| SMILES | CC/C=C\C=C(/C)C1(c2ccccc2)c2ccccc2-c2ccc(C3=C(N)CCC=C3)cc21 |
| InChI | InChI=1S/C32H31N/c1-3-4-6-13-23(2)32(25-14-7-5-8-15-25)29-18-11-9-17-27(29)28-21-20-24(22-30(28)32)26-16-10-12-19-31(26)33/h4-11,13-18,20-22H,3,12,19,33H2,1-2H3/b6-4-,23-13+ |
| InChIKey | WCTMMQZRAOSOPU-VBLQZMESSA-N |
| XLogP | 7.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|