C23H23ClN2 — CID 145292266
4-chloro-7-ethenyl-2-[4-(1-pyrrolidin-1-ylethyl)phenyl]quinoline (PubChem CID 145292266) has the molecular formula C23H23ClN2 and a molecular weight of 362.90 g/mol. Its IUPAC name is 4-chloro-7-ethenyl-2-[4-(1-pyrrolidin-1-ylethyl)phenyl]quinoline.
| Compound Name | 4-chloro-7-ethenyl-2-[4-(1-pyrrolidin-1-ylethyl)phenyl]quinoline |
|---|---|
| PubChem CID | 145292266 |
| Molecular Formula | C23H23ClN2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-chloro-7-ethenyl-2-[4-(1-pyrrolidin-1-ylethyl)phenyl]quinoline |
| SMILES | C=Cc1ccc2c(Cl)cc(-c3ccc(C(C)N4CCCC4)cc3)nc2c1 |
| InChI | InChI=1S/C23H23ClN2/c1-3-17-6-11-20-21(24)15-22(25-23(20)14-17)19-9-7-18(8-10-19)16(2)26-12-4-5-13-26/h3,6-11,14-16H,1,4-5,12-13H2,2H3 |
| InChIKey | ZXBDIVZLHLQSMN-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |