C22H18ClFN2 — CID 129029252
N-[1-[4-(4-chloro-7-ethenylquinolin-2-yl)-2-fluorophenyl]ethenyl]cyclopropanamine (PubChem CID 129029252) has the molecular formula C22H18ClFN2 and a molecular weight of 364.85 g/mol. Its IUPAC name is N-[1-[4-(4-chloro-7-ethenylquinolin-2-yl)-2-fluorophenyl]ethenyl]cyclopropanamine.
| Compound Name | N-[1-[4-(4-chloro-7-ethenylquinolin-2-yl)-2-fluorophenyl]ethenyl]cyclopropanamine |
|---|---|
| PubChem CID | 129029252 |
| Molecular Formula | C22H18ClFN2 |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[1-[4-(4-chloro-7-ethenylquinolin-2-yl)-2-fluorophenyl]ethenyl]cyclopropanamine |
| SMILES | C=Cc1ccc2c(Cl)cc(-c3ccc(C(=C)NC4CC4)c(F)c3)nc2c1 |
| InChI | InChI=1S/C22H18ClFN2/c1-3-14-4-8-18-19(23)12-21(26-22(18)10-14)15-5-9-17(20(24)11-15)13(2)25-16-6-7-16/h3-5,8-12,16,25H,1-2,6-7H2 |
| InChIKey | ACMJUBDRMJYMKO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |