C21H23ClN2 — CID 129028952
N-[(1E)-2-(4-chloro-7-ethenylquinolin-2-yl)buta-1,3-dienyl]-N-methylcyclopentanamine (PubChem CID 129028952) has the molecular formula C21H23ClN2 and a molecular weight of 338.88 g/mol. Its IUPAC name is N-[(1E)-2-(4-chloro-7-ethenylquinolin-2-yl)buta-1,3-dienyl]-N-methylcyclopentanamine.
| Compound Name | N-[(1E)-2-(4-chloro-7-ethenylquinolin-2-yl)buta-1,3-dienyl]-N-methylcyclopentanamine |
|---|---|
| PubChem CID | 129028952 |
| Molecular Formula | C21H23ClN2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-[(1E)-2-(4-chloro-7-ethenylquinolin-2-yl)buta-1,3-dienyl]-N-methylcyclopentanamine |
| SMILES | C=C/C(=C\N(C)C1CCCC1)c1cc(Cl)c2ccc(C=C)cc2n1 |
| InChI | InChI=1S/C21H23ClN2/c1-4-15-10-11-18-19(22)13-20(23-21(18)12-15)16(5-2)14-24(3)17-8-6-7-9-17/h4-5,10-14,17H,1-2,6-9H2,3H3/b16-14+ |
| InChIKey | BWFVRVGMICYNJN-JQIJEIRASA-N |
| XLogP | 5.93 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|