C17H16ClNO — CID 142258405
4-chloro-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-7-methoxyquinoline (PubChem CID 142258405) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is 4-chloro-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-7-methoxyquinoline.
| Compound Name | 4-chloro-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-7-methoxyquinoline |
|---|---|
| PubChem CID | 142258405 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-chloro-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-7-methoxyquinoline |
| SMILES | C=C/C=C\C=C(/C)c1cc(Cl)c2ccc(OC)cc2n1 |
| InChI | InChI=1S/C17H16ClNO/c1-4-5-6-7-12(2)16-11-15(18)14-9-8-13(20-3)10-17(14)19-16/h4-11H,1H2,2-3H3/b6-5-,12-7+ |
| InChIKey | GUOGHOAYWZDIOF-UNKATYBDSA-N |
| XLogP | 5.04 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|