C20H25NO2 — CID 143382060
ethane;2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4,7-dimethoxyquinoline (PubChem CID 143382060) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is ethane;2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4,7-dimethoxyquinoline.
| Compound Name | ethane;2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4,7-dimethoxyquinoline |
|---|---|
| PubChem CID | 143382060 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | ethane;2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4,7-dimethoxyquinoline |
| SMILES | C=C/C(=C\C=C/C)c1cc(OC)c2ccc(OC)cc2n1.CC |
| InChI | InChI=1S/C18H19NO2.C2H6/c1-5-7-8-13(6-2)16-12-18(21-4)15-10-9-14(20-3)11-17(15)19-16;1-2/h5-12H,2H2,1,3-4H3;1-2H3/b7-5-,13-8+; |
| InChIKey | PMQQHGRRXOQNRE-ODBUDDLKSA-N |
| XLogP | 5.42 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|