C15H28N4O5 — CID 145293742
2-hydrazinyl-3-methoxy-N-[2-[[(2S)-4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]amino]-2-oxoethyl]propanamide (PubChem CID 145293742) has the molecular formula C15H28N4O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-hydrazinyl-3-methoxy-N-[2-[[(2S)-4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]amino]-2-oxoethyl]propanamide.
| Compound Name | 2-hydrazinyl-3-methoxy-N-[2-[[(2S)-4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]amino]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 145293742 |
| Molecular Formula | C15H28N4O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-hydrazinyl-3-methoxy-N-[2-[[(2S)-4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]amino]-2-oxoethyl]propanamide |
| SMILES | COCC(NN)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C15H28N4O5/c1-9(2)5-10(13(21)15(3)8-24-15)18-12(20)6-17-14(22)11(19-16)7-23-4/h9-11,19H,5-8,16H2,1-4H3,(H,17,22)(H,18,20)/t10-,11?,15?/m0/s1 |
| InChIKey | TYXSJTXALMBOOP-NLTNOIMHSA-N |
| XLogP | -1.53 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|