C26H44O3 — CID 145294014
17-(2,3-dihydroxy-5-methylhexyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one (PubChem CID 145294014) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is 17-(2,3-dihydroxy-5-methylhexyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one.
| Compound Name | 17-(2,3-dihydroxy-5-methylhexyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 145294014 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 17-(2,3-dihydroxy-5-methylhexyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
| SMILES | CC(C)CC(O)C(O)CC1CCC2C3CC(=O)C4CCCCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H44O3/c1-16(2)13-23(28)24(29)14-17-8-9-19-18-15-22(27)21-7-5-6-11-26(21,4)20(18)10-12-25(17,19)3/h16-21,23-24,28-29H,5-15H2,1-4H3 |
| InChIKey | UQIDTWHABMNXQA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |