About but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate
but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate (PubChem CID 145294176) has the molecular formula C20H35NO2
and a molecular weight of 321.51 g/mol. Its IUPAC name is but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate.
Molecular Properties
| Compound Name | but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate |
| PubChem CID | 145294176 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate |
| SMILES | C=CCC.CC.CC.CC/C=C/c1ccccc1NC(=O)OC |
| InChI | InChI=1S/C12H15NO2.C4H8.2C2H6/c1-3-4-7-10-8-5-6-9-11(10)13-12(14)15-2;1-3-4-2;2*1-2/h4-9H,3H2,1-2H3,(H,13,14);3H,1,4H2,2H3;2*1-2H3/b7-4+;;; |
| InChIKey | QGOPUUDBIQWQLV-QNEYZHQCSA-N |
| XLogP | 6.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate?
The IUPAC name of but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate (CID 145294176) is but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate.
What is the SMILES notation for but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate?
The canonical SMILES for but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate is C=CCC.CC.CC.CC/C=C/c1ccccc1NC(=O)OC.
What is the InChIKey of but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate?
The InChIKey is QGOPUUDBIQWQLV-QNEYZHQCSA-N. The full InChI is InChI=1S/C12H15NO2.C4H8.2C2H6/c1-3-4-7-10-8-5-6-9-11(10)13-12(14)15-2;1-3-4-2;2*1-2/h4-9H,3H2,1-2H3,(H,13,14);3H,1,4H2,2H3;2*1-2H3/b7-4+;;;.
What are the key properties of but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate?
but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate has a molecular weight of 321.51 g/mol, XLogP of 6.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate is sourced from PubChem (CID 145294176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).