C20H35NO2 — CID 145294176
but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate (PubChem CID 145294176) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate.
| Compound Name | but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate |
|---|---|
| PubChem CID | 145294176 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | but-1-ene;ethane;methyl N-[2-[(E)-but-1-enyl]phenyl]carbamate |
| SMILES | C=CCC.CC.CC.CC/C=C/c1ccccc1NC(=O)OC |
| InChI | InChI=1S/C12H15NO2.C4H8.2C2H6/c1-3-4-7-10-8-5-6-9-11(10)13-12(14)15-2;1-3-4-2;2*1-2/h4-9H,3H2,1-2H3,(H,13,14);3H,1,4H2,2H3;2*1-2H3/b7-4+;;; |
| InChIKey | QGOPUUDBIQWQLV-QNEYZHQCSA-N |
| XLogP | 6.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|