About fluoro 4-aminosulfanylbenzoate
fluoro 4-aminosulfanylbenzoate (PubChem CID 145294745) has the molecular formula C7H6FNO2S
and a molecular weight of 187.20 g/mol. Its IUPAC name is fluoro 4-aminosulfanylbenzoate.
Molecular Properties
| Compound Name | fluoro 4-aminosulfanylbenzoate |
| PubChem CID | 145294745 |
| Molecular Formula | C7H6FNO2S |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | fluoro 4-aminosulfanylbenzoate |
| SMILES | NSc1ccc(C(=O)OF)cc1 |
| InChI | InChI=1S/C7H6FNO2S/c8-11-7(10)5-1-3-6(12-9)4-2-5/h1-4H,9H2 |
| InChIKey | MIDNXBFAJVKOQZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze fluoro 4-aminosulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 4-aminosulfanylbenzoate?
The IUPAC name of fluoro 4-aminosulfanylbenzoate (CID 145294745) is fluoro 4-aminosulfanylbenzoate.
What is the SMILES notation for fluoro 4-aminosulfanylbenzoate?
The canonical SMILES for fluoro 4-aminosulfanylbenzoate is NSc1ccc(C(=O)OF)cc1.
What is the InChIKey of fluoro 4-aminosulfanylbenzoate?
The InChIKey is MIDNXBFAJVKOQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO2S/c8-11-7(10)5-1-3-6(12-9)4-2-5/h1-4H,9H2.
What are the key properties of fluoro 4-aminosulfanylbenzoate?
fluoro 4-aminosulfanylbenzoate has a molecular weight of 187.20 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 4-aminosulfanylbenzoate is sourced from PubChem (CID 145294745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).