C23H24ClN5O3 — CID 145296039
N-[4-(3-chloro-2-methoxyphenoxy)phenyl]-N-[4-[(1-methylpyrrolidin-3-yl)amino]-3-pyridinyl]nitrous amide (PubChem CID 145296039) has the molecular formula C23H24ClN5O3 and a molecular weight of 453.93 g/mol. Its IUPAC name is N-[4-(3-chloro-2-methoxyphenoxy)phenyl]-N-[4-[(1-methylpyrrolidin-3-yl)amino]-3-pyridinyl]nitrous amide.
| Compound Name | N-[4-(3-chloro-2-methoxyphenoxy)phenyl]-N-[4-[(1-methylpyrrolidin-3-yl)amino]-3-pyridinyl]nitrous amide |
|---|---|
| PubChem CID | 145296039 |
| Molecular Formula | C23H24ClN5O3 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[4-(3-chloro-2-methoxyphenoxy)phenyl]-N-[4-[(1-methylpyrrolidin-3-yl)amino]-3-pyridinyl]nitrous amide |
| SMILES | COc1c(Cl)cccc1Oc1ccc(N(N=O)c2cnccc2NC2CCN(C)C2)cc1 |
| InChI | InChI=1S/C23H24ClN5O3/c1-28-13-11-16(15-28)26-20-10-12-25-14-21(20)29(27-30)17-6-8-18(9-7-17)32-22-5-3-4-19(24)23(22)31-2/h3-10,12,14,16H,11,13,15H2,1-2H3,(H,25,26) |
| InChIKey | CFKRIIPNQQAQDU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|