C19H24ClFN4O2 — CID 145296502
1-(4-chloro-3-fluorophenyl)-3-[2-[1-[(Z)-2-hydroxyprop-2-enylideneamino]ethenyl-methylamino]ethyl-methylamino]pyrrolidin-2-one (PubChem CID 145296502) has the molecular formula C19H24ClFN4O2 and a molecular weight of 394.88 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-[2-[1-[(Z)-2-hydroxyprop-2-enylideneamino]ethenyl-methylamino]ethyl-methylamino]pyrrolidin-2-one.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-[2-[1-[(Z)-2-hydroxyprop-2-enylideneamino]ethenyl-methylamino]ethyl-methylamino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 145296502 |
| Molecular Formula | C19H24ClFN4O2 |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-[2-[1-[(Z)-2-hydroxyprop-2-enylideneamino]ethenyl-methylamino]ethyl-methylamino]pyrrolidin-2-one |
| SMILES | C=C(O)/C=N\C(=C)N(C)CCN(C)C1CCN(c2ccc(Cl)c(F)c2)C1=O |
| InChI | InChI=1S/C19H24ClFN4O2/c1-13(26)12-22-14(2)23(3)9-10-24(4)18-7-8-25(19(18)27)15-5-6-16(20)17(21)11-15/h5-6,11-12,18,26H,1-2,7-10H2,3-4H3/b22-12- |
| InChIKey | WFMLVWDCQQUXIK-UUYOSTAYSA-N |
| XLogP | 3.06 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|