C25H28N2 — CID 145297951
ethane;2-ethynyl-N-methyl-5-[6-methylidene-1-[(3-methylphenyl)methyl]-3-pyridinyl]aniline (PubChem CID 145297951) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is ethane;2-ethynyl-N-methyl-5-[6-methylidene-1-[(3-methylphenyl)methyl]-3-pyridinyl]aniline.
| Compound Name | ethane;2-ethynyl-N-methyl-5-[6-methylidene-1-[(3-methylphenyl)methyl]-3-pyridinyl]aniline |
|---|---|
| PubChem CID | 145297951 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | ethane;2-ethynyl-N-methyl-5-[6-methylidene-1-[(3-methylphenyl)methyl]-3-pyridinyl]aniline |
| SMILES | C#Cc1ccc(C2=CN(Cc3cccc(C)c3)C(=C)C=C2)cc1NC.CC |
| InChI | InChI=1S/C23H22N2.C2H6/c1-5-20-11-12-21(14-23(20)24-4)22-10-9-18(3)25(16-22)15-19-8-6-7-17(2)13-19;1-2/h1,6-14,16,24H,3,15H2,2,4H3;1-2H3 |
| InChIKey | KWOYGWSNPFOXLF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|