C16H27N — CID 145299359
(Z)-2,2,3-trimethyl-5-methylidene-N-prop-1-en-2-ylnon-3-en-1-imine (PubChem CID 145299359) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (Z)-2,2,3-trimethyl-5-methylidene-N-prop-1-en-2-ylnon-3-en-1-imine.
| Compound Name | (Z)-2,2,3-trimethyl-5-methylidene-N-prop-1-en-2-ylnon-3-en-1-imine |
|---|---|
| PubChem CID | 145299359 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (Z)-2,2,3-trimethyl-5-methylidene-N-prop-1-en-2-ylnon-3-en-1-imine |
| SMILES | C=C(/C=C(/C)C(C)(C)/C=N/C(=C)C)CCCC |
| InChI | InChI=1S/C16H27N/c1-8-9-10-14(4)11-15(5)16(6,7)12-17-13(2)3/h11-12H,2,4,8-10H2,1,3,5-7H3/b15-11-,17-12+ |
| InChIKey | TUFOIWMQVWJRQW-AJGWWKNYSA-N |
| XLogP | 5.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|