C19H22N4O5 — CID 145303852
14-formyl-5-(methoxycarbonylamino)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaene-9-carboxylic acid (PubChem CID 145303852) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is 14-formyl-5-(methoxycarbonylamino)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaene-9-carboxylic acid.
| Compound Name | 14-formyl-5-(methoxycarbonylamino)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaene-9-carboxylic acid |
|---|---|
| PubChem CID | 145303852 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 14-formyl-5-(methoxycarbonylamino)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaene-9-carboxylic acid |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(C(=O)O)CCCCC(C=O)c1ncc-2[nH]1 |
| InChI | InChI=1S/C19H22N4O5/c1-28-19(27)21-12-6-7-13-15(8-12)22-14(18(25)26)5-3-2-4-11(10-24)17-20-9-16(13)23-17/h6-11,14,22H,2-5H2,1H3,(H,20,23)(H,21,27)(H,25,26) |
| InChIKey | GIUAEPZLDINOBJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|