C20H24N6O2S — CID 155029024
methyl N-[(14S)-14-amino-9-(1,3-thiazol-4-yl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate (PubChem CID 155029024) has the molecular formula C20H24N6O2S and a molecular weight of 412.52 g/mol. Its IUPAC name is methyl N-[(14S)-14-amino-9-(1,3-thiazol-4-yl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[(14S)-14-amino-9-(1,3-thiazol-4-yl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 155029024 |
| Molecular Formula | C20H24N6O2S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | methyl N-[(14S)-14-amino-9-(1,3-thiazol-4-yl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(c1cscn1)CCCC[C@H](N)c1ncc-2[nH]1 |
| InChI | InChI=1S/C20H24N6O2S/c1-28-20(27)24-12-6-7-13-16(8-12)25-15(18-10-29-11-23-18)5-3-2-4-14(21)19-22-9-17(13)26-19/h6-11,14-15,25H,2-5,21H2,1H3,(H,22,26)(H,24,27)/t14-,15?/m0/s1 |
| InChIKey | CESPDLBLWGUWMV-MLCCFXAWSA-N |
| XLogP | 4.44 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |