C19H26N6O2 — CID 155028984
methyl N-[(14S)-14-amino-17-(methyliminomethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate (PubChem CID 155028984) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is methyl N-[(14S)-14-amino-17-(methyliminomethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[(14S)-14-amino-17-(methyliminomethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 155028984 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | methyl N-[(14S)-14-amino-17-(methyliminomethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
| SMILES | C/N=C/c1[nH]c2nc1-c1ccc(NC(=O)OC)cc1NCCCCC[C@@H]2N |
| InChI | InChI=1S/C19H26N6O2/c1-21-11-16-17-13-8-7-12(23-19(26)27-2)10-15(13)22-9-5-3-4-6-14(20)18(24-16)25-17/h7-8,10-11,14,22H,3-6,9,20H2,1-2H3,(H,23,26)(H,24,25)/b21-11+/t14-/m0/s1 |
| InChIKey | FZHRFUVQESUWEP-FVUPAENESA-N |
| XLogP | 3.29 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|