C28H30ClN9O3 — CID 155028925
methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(hydrazinylmethylideneamino)phenyl]prop-2-enoyl]amino]-17-cyano-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate (PubChem CID 155028925) has the molecular formula C28H30ClN9O3 and a molecular weight of 576.06 g/mol. Its IUPAC name is methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(hydrazinylmethylideneamino)phenyl]prop-2-enoyl]amino]-17-cyano-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(hydrazinylmethylideneamino)phenyl]prop-2-enoyl]amino]-17-cyano-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 155028925 |
| Molecular Formula | C28H30ClN9O3 |
| Molecular Weight | 576.06 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(hydrazinylmethylideneamino)phenyl]prop-2-enoyl]amino]-17-cyano-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NCCCCC[C@H](NC(=O)/C=C/c1cc(Cl)ccc1/N=C/NN)c1nc(C#N)c-2[nH]1 |
| InChI | InChI=1S/C28H30ClN9O3/c1-41-28(40)35-19-8-9-20-23(14-19)32-12-4-2-3-5-22(27-37-24(15-30)26(20)38-27)36-25(39)11-6-17-13-18(29)7-10-21(17)33-16-34-31/h6-11,13-14,16,22,32H,2-5,12,31H2,1H3,(H,33,34)(H,35,40)(H,36,39)(H,37,38)/b11-6+/t22-/m0/s1 |
| InChIKey | XHEFXZDYXSFDHG-PQCZLFTGSA-N |
| XLogP | 4.76 |
| TPSA | 182.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.06 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|