C31H34ClN9O4 — CID 91801016
[(2R)-oxolan-2-yl]methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate (PubChem CID 91801016) has the molecular formula C31H34ClN9O4 and a molecular weight of 632.13 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate.
| Compound Name | [(2R)-oxolan-2-yl]methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 91801016 |
| Molecular Formula | C31H34ClN9O4 |
| Molecular Weight | 632.13 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1-n1cnnn1)N[C@H]1CCCCCNc2cc(NC(=O)OC[C@H]3CCCO3)ccc2-c2cnc1[nH]2 |
| InChI | InChI=1S/C31H34ClN9O4/c32-21-8-11-28(41-19-35-39-40-41)20(15-21)7-12-29(42)37-25-6-2-1-3-13-33-26-16-22(9-10-24(26)27-17-34-30(25)38-27)36-31(43)45-18-23-5-4-14-44-23/h7-12,15-17,19,23,25,33H,1-6,13-14,18H2,(H,34,38)(H,36,43)(H,37,42)/b12-7+/t23-,25+/m1/s1 |
| InChIKey | DZTIZOIMYLLLKV-BYMRBSSPSA-N |
| XLogP | 5.29 |
| TPSA | 160.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.13 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|