C28H29ClN10O4 — CID 77408275
methyl N-[17-carbamoyl-14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate (PubChem CID 77408275) has the molecular formula C28H29ClN10O4 and a molecular weight of 605.06 g/mol. Its IUPAC name is methyl N-[17-carbamoyl-14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[17-carbamoyl-14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 77408275 |
| Molecular Formula | C28H29ClN10O4 |
| Molecular Weight | 605.06 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | methyl N-[17-carbamoyl-14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NCCCCCC(NC(=O)C=Cc1cc(Cl)ccc1-n1cnnn1)c1nc-2c(C(N)=O)[nH]1 |
| InChI | InChI=1S/C28H29ClN10O4/c1-43-28(42)33-18-8-9-19-21(14-18)31-12-4-2-3-5-20(27-35-24(19)25(36-27)26(30)41)34-23(40)11-6-16-13-17(29)7-10-22(16)39-15-32-37-38-39/h6-11,13-15,20,31H,2-5,12H2,1H3,(H2,30,41)(H,33,42)(H,34,40)(H,35,36) |
| InChIKey | LFPVGLXDZXMBPB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 194.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.06 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|