C28H29ClN10O3 — CID 137285167
methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-17-methanimidoyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate (PubChem CID 137285167) has the molecular formula C28H29ClN10O3 and a molecular weight of 589.06 g/mol. Its IUPAC name is methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-17-methanimidoyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-17-methanimidoyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 137285167 |
| Molecular Formula | C28H29ClN10O3 |
| Molecular Weight | 589.06 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | methyl N-[(14S)-14-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-17-methanimidoyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
| SMILES | [H]/N=C/c1[nH]c2nc1-c1ccc(NC(=O)OC)cc1NCCCCC[C@@H]2NC(=O)/C=C/c1cc(Cl)ccc1-n1cnnn1 |
| InChI | InChI=1S/C28H29ClN10O3/c1-42-28(41)33-19-8-9-20-22(14-19)31-12-4-2-3-5-21(27-35-23(15-30)26(20)36-27)34-25(40)11-6-17-13-18(29)7-10-24(17)39-16-32-37-38-39/h6-11,13-16,21,30-31H,2-5,12H2,1H3,(H,33,41)(H,34,40)(H,35,36)/b11-6+,30-15+/t21-/m0/s1 |
| InChIKey | HYJKLGFRYRXGFS-IUIJAZPWSA-N |
| XLogP | 4.74 |
| TPSA | 175.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.06 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|