C28H28ClN9O4 — CID 77183896
methyl N-[14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-17-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate (PubChem CID 77183896) has the molecular formula C28H28ClN9O4 and a molecular weight of 590.04 g/mol. Its IUPAC name is methyl N-[14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-17-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-17-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 77183896 |
| Molecular Formula | C28H28ClN9O4 |
| Molecular Weight | 590.04 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | methyl N-[14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-17-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)CCCCC(NC(=O)C=Cc1cc(Cl)ccc1-n1cnnn1)c1nc-2c(C)[nH]1 |
| InChI | InChI=1S/C28H28ClN9O4/c1-16-26-20-10-9-19(32-28(41)42-2)14-22(20)34-24(39)6-4-3-5-21(27(31-16)35-26)33-25(40)12-7-17-13-18(29)8-11-23(17)38-15-30-36-37-38/h7-15,21H,3-6H2,1-2H3,(H,31,35)(H,32,41)(H,33,40)(H,34,39) |
| InChIKey | OMNFWOLUWXIEIT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 168.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.04 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|