C27H32N6O3 — CID 149479748
methyl N-[(9R,15S)-15-amino-9-(pyridin-2-ylmethylcarbamoyl)-8,18-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate (PubChem CID 149479748) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is methyl N-[(9R,15S)-15-amino-9-(pyridin-2-ylmethylcarbamoyl)-8,18-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate.
| Compound Name | methyl N-[(9R,15S)-15-amino-9-(pyridin-2-ylmethylcarbamoyl)-8,18-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate |
|---|---|
| PubChem CID | 149479748 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | methyl N-[(9R,15S)-15-amino-9-(pyridin-2-ylmethylcarbamoyl)-8,18-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)N[C@@H](C(=O)NCc1ccccn1)CCCCC[C@H](N)c1cncc-2c1 |
| InChI | InChI=1S/C27H32N6O3/c1-36-27(35)32-20-10-11-22-18-13-19(16-29-15-18)23(28)8-3-2-4-9-24(33-25(22)14-20)26(34)31-17-21-7-5-6-12-30-21/h5-7,10-16,23-24,33H,2-4,8-9,17,28H2,1H3,(H,31,34)(H,32,35)/t23-,24+/m0/s1 |
| InChIKey | ZCZXONNIFKBEAK-BJKOFHAPSA-N |
| XLogP | 4.38 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |