C29H35BrClN3O3 — CID 145305096
6-bromo-2-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1H-indole;[1-(2-formamidoethyl)piperidin-4-yl] butanoate (PubChem CID 145305096) has the molecular formula C29H35BrClN3O3 and a molecular weight of 588.97 g/mol. Its IUPAC name is 6-bromo-2-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1H-indole;[1-(2-formamidoethyl)piperidin-4-yl] butanoate.
| Compound Name | 6-bromo-2-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1H-indole;[1-(2-formamidoethyl)piperidin-4-yl] butanoate |
|---|---|
| PubChem CID | 145305096 |
| Molecular Formula | C29H35BrClN3O3 |
| Molecular Weight | 588.97 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | 6-bromo-2-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1H-indole;[1-(2-formamidoethyl)piperidin-4-yl] butanoate |
| SMILES | CCCC(=O)OC1CCN(CCNC=O)CC1.Cc1c(/C=C/c2ccc(Cl)cc2)[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C17H13BrClN.C12H22N2O3/c1-11-15-8-5-13(18)10-17(15)20-16(11)9-4-12-2-6-14(19)7-3-12;1-2-3-12(16)17-11-4-7-14(8-5-11)9-6-13-10-15/h2-10,20H,1H3;10-11H,2-9H2,1H3,(H,13,15)/b9-4+; |
| InChIKey | MVNPSLFUFJROFF-JOKMOOFLSA-N |
| XLogP | 6.60 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.97 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|