About (1-propylpiperidin-4-yl) 3-aminopropanoate
(1-propylpiperidin-4-yl) 3-aminopropanoate (PubChem CID 70927210) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is (1-propylpiperidin-4-yl) 3-aminopropanoate.
Molecular Properties
| Compound Name | (1-propylpiperidin-4-yl) 3-aminopropanoate |
| PubChem CID | 70927210 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (1-propylpiperidin-4-yl) 3-aminopropanoate |
| SMILES | CCCN1CCC(OC(=O)CCN)CC1 |
| InChI | InChI=1S/C11H22N2O2/c1-2-7-13-8-4-10(5-9-13)15-11(14)3-6-12/h10H,2-9,12H2,1H3 |
| InChIKey | ILXCXWSLYUJRIP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-propylpiperidin-4-yl) 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propylpiperidin-4-yl) 3-aminopropanoate?
The IUPAC name of (1-propylpiperidin-4-yl) 3-aminopropanoate (CID 70927210) is (1-propylpiperidin-4-yl) 3-aminopropanoate.
What is the SMILES notation for (1-propylpiperidin-4-yl) 3-aminopropanoate?
The canonical SMILES for (1-propylpiperidin-4-yl) 3-aminopropanoate is CCCN1CCC(OC(=O)CCN)CC1.
What is the InChIKey of (1-propylpiperidin-4-yl) 3-aminopropanoate?
The InChIKey is ILXCXWSLYUJRIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-2-7-13-8-4-10(5-9-13)15-11(14)3-6-12/h10H,2-9,12H2,1H3.
What are the key properties of (1-propylpiperidin-4-yl) 3-aminopropanoate?
(1-propylpiperidin-4-yl) 3-aminopropanoate has a molecular weight of 214.31 g/mol, XLogP of 0.75, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propylpiperidin-4-yl) 3-aminopropanoate is sourced from PubChem (CID 70927210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).