About (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate
(1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate (PubChem CID 70927205) has the molecular formula C18H35N3O2
and a molecular weight of 325.50 g/mol. Its IUPAC name is (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate.
Molecular Properties
| Compound Name | (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate |
| PubChem CID | 70927205 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate |
| SMILES | CCCN1CCC(OC(=O)CCN2CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C18H35N3O2/c1-4-8-19-9-5-17(6-10-19)23-18(22)7-11-20-12-14-21(15-13-20)16(2)3/h16-17H,4-15H2,1-3H3 |
| InChIKey | SAMJAVDVEGKXJC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate?
The IUPAC name of (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate (CID 70927205) is (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate.
What is the SMILES notation for (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate?
The canonical SMILES for (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate is CCCN1CCC(OC(=O)CCN2CCN(C(C)C)CC2)CC1.
What is the InChIKey of (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate?
The InChIKey is SAMJAVDVEGKXJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N3O2/c1-4-8-19-9-5-17(6-10-19)23-18(22)7-11-20-12-14-21(15-13-20)16(2)3/h16-17H,4-15H2,1-3H3.
What are the key properties of (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate?
(1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate has a molecular weight of 325.50 g/mol, XLogP of 1.82, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propylpiperidin-4-yl) 3-(4-propan-2-ylpiperazin-1-yl)propanoate is sourced from PubChem (CID 70927205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).