C25H22F2N4 — CID 145305491
9,9-difluoro-7-[2-(1-methylpyrrolidin-2-yl)-3H-benzimidazol-5-yl]fluoren-2-amine (PubChem CID 145305491) has the molecular formula C25H22F2N4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 9,9-difluoro-7-[2-(1-methylpyrrolidin-2-yl)-3H-benzimidazol-5-yl]fluoren-2-amine.
| Compound Name | 9,9-difluoro-7-[2-(1-methylpyrrolidin-2-yl)-3H-benzimidazol-5-yl]fluoren-2-amine |
|---|---|
| PubChem CID | 145305491 |
| Molecular Formula | C25H22F2N4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 9,9-difluoro-7-[2-(1-methylpyrrolidin-2-yl)-3H-benzimidazol-5-yl]fluoren-2-amine |
| SMILES | CN1CCCC1c1nc2ccc(-c3ccc4c(c3)C(F)(F)c3cc(N)ccc3-4)cc2[nH]1 |
| InChI | InChI=1S/C25H22F2N4/c1-31-10-2-3-23(31)24-29-21-9-5-15(12-22(21)30-24)14-4-7-17-18-8-6-16(28)13-20(18)25(26,27)19(17)11-14/h4-9,11-13,23H,2-3,10,28H2,1H3,(H,29,30) |
| InChIKey | NNNKIOGKEPITND-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|