C29H30N4 — CID 129126007
9,9-dimethyl-7-[4-[2-(1-methylpyrrolidin-2-yl)-1H-imidazol-5-yl]phenyl]fluoren-2-amine (PubChem CID 129126007) has the molecular formula C29H30N4 and a molecular weight of 434.59 g/mol. Its IUPAC name is 9,9-dimethyl-7-[4-[2-(1-methylpyrrolidin-2-yl)-1H-imidazol-5-yl]phenyl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-7-[4-[2-(1-methylpyrrolidin-2-yl)-1H-imidazol-5-yl]phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 129126007 |
| Molecular Formula | C29H30N4 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 9,9-dimethyl-7-[4-[2-(1-methylpyrrolidin-2-yl)-1H-imidazol-5-yl]phenyl]fluoren-2-amine |
| SMILES | CN1CCCC1c1ncc(-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(N)ccc3-4)cc2)[nH]1 |
| InChI | InChI=1S/C29H30N4/c1-29(2)24-15-20(10-12-22(24)23-13-11-21(30)16-25(23)29)18-6-8-19(9-7-18)26-17-31-28(32-26)27-5-4-14-33(27)3/h6-13,15-17,27H,4-5,14,30H2,1-3H3,(H,31,32) |
| InChIKey | UMUFZPSIBUIWQE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|