C24H23N5O2 — CID 118244741
5-[6-[2-[(2S)-1-methylpyrrolidin-2-yl]-1H-imidazol-5-yl]naphthalen-2-yl]-2-nitroaniline (PubChem CID 118244741) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 5-[6-[2-[(2S)-1-methylpyrrolidin-2-yl]-1H-imidazol-5-yl]naphthalen-2-yl]-2-nitroaniline.
| Compound Name | 5-[6-[2-[(2S)-1-methylpyrrolidin-2-yl]-1H-imidazol-5-yl]naphthalen-2-yl]-2-nitroaniline |
|---|---|
| PubChem CID | 118244741 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 5-[6-[2-[(2S)-1-methylpyrrolidin-2-yl]-1H-imidazol-5-yl]naphthalen-2-yl]-2-nitroaniline |
| SMILES | CN1CCC[C@H]1c1ncc(-c2ccc3cc(-c4ccc([N+](=O)[O-])c(N)c4)ccc3c2)[nH]1 |
| InChI | InChI=1S/C24H23N5O2/c1-28-10-2-3-23(28)24-26-14-21(27-24)19-7-6-15-11-16(4-5-17(15)12-19)18-8-9-22(29(30)31)20(25)13-18/h4-9,11-14,23H,2-3,10,25H2,1H3,(H,26,27)/t23-/m0/s1 |
| InChIKey | BTFGQGLPALWJDL-QHCPKHFHSA-N |
| XLogP | 5.15 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|