C8H11F2N3 — CID 145305666
(1Z,4Z,7E)-3,8-difluoro-3,6-dimethyl-1,4-diazocin-6-amine (PubChem CID 145305666) has the molecular formula C8H11F2N3 and a molecular weight of 187.19 g/mol. Its IUPAC name is (1Z,4Z,7E)-3,8-difluoro-3,6-dimethyl-1,4-diazocin-6-amine.
| Compound Name | (1Z,4Z,7E)-3,8-difluoro-3,6-dimethyl-1,4-diazocin-6-amine |
|---|---|
| PubChem CID | 145305666 |
| Molecular Formula | C8H11F2N3 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | (1Z,4Z,7E)-3,8-difluoro-3,6-dimethyl-1,4-diazocin-6-amine |
| SMILES | CC1(N)/C=N\C(C)(F)/C=N\C(F)=C/1 |
| InChI | InChI=1S/C8H11F2N3/c1-7(11)3-6(9)12-5-8(2,10)13-4-7/h3-5H,11H2,1-2H3/b6-3-,12-5-,13-4- |
| InChIKey | ROTSVQHXQLJCBT-TUITVHIRSA-N |
| XLogP | 1.36 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|