C18H27N3S — CID 145306123
N-[(4R)-1-(2-methylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]thiohydroxylamine;2-methylpropane (PubChem CID 145306123) has the molecular formula C18H27N3S and a molecular weight of 317.50 g/mol. Its IUPAC name is N-[(4R)-1-(2-methylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]thiohydroxylamine;2-methylpropane.
| Compound Name | N-[(4R)-1-(2-methylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]thiohydroxylamine;2-methylpropane |
|---|---|
| PubChem CID | 145306123 |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-[(4R)-1-(2-methylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]thiohydroxylamine;2-methylpropane |
| SMILES | CC(C)C.Cc1ccccc1-n1ncc2c1CCC[C@H]2NS |
| InChI | InChI=1S/C14H17N3S.C4H10/c1-10-5-2-3-7-13(10)17-14-8-4-6-12(16-18)11(14)9-15-17;1-4(2)3/h2-3,5,7,9,12,16,18H,4,6,8H2,1H3;4H,1-3H3/t12-;/m1./s1 |
| InChIKey | ZIOQXDORCBNFCU-UTONKHPSSA-N |
| XLogP | 4.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|