C16H20O4 — CID 145309466
[2-(methoxymethyl)-5-(3-oxopropyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 145309466) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is [2-(methoxymethyl)-5-(3-oxopropyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [2-(methoxymethyl)-5-(3-oxopropyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145309466 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [2-(methoxymethyl)-5-(3-oxopropyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(CCC=O)ccc1COC |
| InChI | InChI=1S/C16H20O4/c1-12(2)16(18)20-11-15-9-13(5-4-8-17)6-7-14(15)10-19-3/h6-9H,1,4-5,10-11H2,2-3H3 |
| InChIKey | AMVNKJRFHBUUEO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|