C47H36N4O — CID 145309550
7-(5-methyl-2-pyridinyl)-7-phenyl-N'-[C-phenyl-N-(1-phenylethyl)carbonimidoyl]fluoreno[4,3-b][1]benzofuran-5-carboximidamide (PubChem CID 145309550) has the molecular formula C47H36N4O and a molecular weight of 672.83 g/mol. Its IUPAC name is 7-(5-methyl-2-pyridinyl)-7-phenyl-N'-[C-phenyl-N-(1-phenylethyl)carbonimidoyl]fluoreno[4,3-b][1]benzofuran-5-carboximidamide.
| Compound Name | 7-(5-methyl-2-pyridinyl)-7-phenyl-N'-[C-phenyl-N-(1-phenylethyl)carbonimidoyl]fluoreno[4,3-b][1]benzofuran-5-carboximidamide |
|---|---|
| PubChem CID | 145309550 |
| Molecular Formula | C47H36N4O |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | 7-(5-methyl-2-pyridinyl)-7-phenyl-N'-[C-phenyl-N-(1-phenylethyl)carbonimidoyl]fluoreno[4,3-b][1]benzofuran-5-carboximidamide |
| SMILES | Cc1ccc(C2(c3ccccc3)c3ccccc3-c3c2cc(/C(N)=N/C(=N/C(C)c2ccccc2)c2ccccc2)c2c3oc3ccccc32)nc1 |
| InChI | InChI=1S/C47H36N4O/c1-30-26-27-41(49-29-30)47(34-20-10-5-11-21-34)38-24-14-12-22-35(38)43-39(47)28-37(42-36-23-13-15-25-40(36)52-44(42)43)45(48)51-46(33-18-8-4-9-19-33)50-31(2)32-16-6-3-7-17-32/h3-29,31H,1-2H3,(H2,48,50,51) |
| InChIKey | VCOVDICHOHQZOQ-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|