About 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone
1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone (PubChem CID 1453107) has the molecular formula C17H18N4OS3
and a molecular weight of 390.56 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone.
Molecular Properties
| Compound Name | 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone |
| PubChem CID | 1453107 |
| Molecular Formula | C17H18N4OS3 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone |
| SMILES | O=C(CSc1ncnc2c(-c3cccs3)nsc12)N1CCCCCC1 |
| InChI | InChI=1S/C17H18N4OS3/c22-13(21-7-3-1-2-4-8-21)10-24-17-16-15(18-11-19-17)14(20-25-16)12-6-5-9-23-12/h5-6,9,11H,1-4,7-8,10H2 |
| InChIKey | SQELKFGREWWFSV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone?
The IUPAC name of 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone (CID 1453107) is 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone.
What is the SMILES notation for 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone?
The canonical SMILES for 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone is O=C(CSc1ncnc2c(-c3cccs3)nsc12)N1CCCCCC1.
What is the InChIKey of 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone?
The InChIKey is SQELKFGREWWFSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4OS3/c22-13(21-7-3-1-2-4-8-21)10-24-17-16-15(18-11-19-17)14(20-25-16)12-6-5-9-23-12/h5-6,9,11H,1-4,7-8,10H2.
What are the key properties of 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone?
1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone has a molecular weight of 390.56 g/mol, XLogP of 4.31, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azepan-1-yl)-2-[(3-thiophen-2-yl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)sulfanyl]ethanone is sourced from PubChem (CID 1453107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).