C15H17N3OS2 — CID 12006152
1-piperidin-1-yl-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylethanone (PubChem CID 12006152) has the molecular formula C15H17N3OS2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylethanone.
| Compound Name | 1-piperidin-1-yl-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylethanone |
|---|---|
| PubChem CID | 12006152 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-piperidin-1-yl-2-(6-thiophen-2-ylpyridazin-3-yl)sulfanylethanone |
| SMILES | O=C(CSc1ccc(-c2cccs2)nn1)N1CCCCC1 |
| InChI | InChI=1S/C15H17N3OS2/c19-15(18-8-2-1-3-9-18)11-21-14-7-6-12(16-17-14)13-5-4-10-20-13/h4-7,10H,1-3,8-9,11H2 |
| InChIKey | FDVGLZNJTWCMOV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |